C20H30N2O5S — CID 141491131
tert-butyl 4-methyl-4-[[2-(4-methylsulfonylphenyl)acetyl]amino]piperidine-1-carboxylate (PubChem CID 141491131) has the molecular formula C20H30N2O5S and a molecular weight of 410.54 g/mol. Its IUPAC name is tert-butyl 4-methyl-4-[[2-(4-methylsulfonylphenyl)acetyl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-methyl-4-[[2-(4-methylsulfonylphenyl)acetyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 141491131 |
| Molecular Formula | C20H30N2O5S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | tert-butyl 4-methyl-4-[[2-(4-methylsulfonylphenyl)acetyl]amino]piperidine-1-carboxylate |
| SMILES | CC1(NC(=O)Cc2ccc(S(C)(=O)=O)cc2)CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C20H30N2O5S/c1-19(2,3)27-18(24)22-12-10-20(4,11-13-22)21-17(23)14-15-6-8-16(9-7-15)28(5,25)26/h6-9H,10-14H2,1-5H3,(H,21,23) |
| InChIKey | GAHBNJSJRZHIAC-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |