C21H32N2O5S — CID 69264341
tert-butyl 4-ethyl-4-[(4-methylsulfonylphenyl)methylcarbamoyl]piperidine-1-carboxylate (PubChem CID 69264341) has the molecular formula C21H32N2O5S and a molecular weight of 424.56 g/mol. Its IUPAC name is tert-butyl 4-ethyl-4-[(4-methylsulfonylphenyl)methylcarbamoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-ethyl-4-[(4-methylsulfonylphenyl)methylcarbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 69264341 |
| Molecular Formula | C21H32N2O5S |
| Molecular Weight | 424.56 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | tert-butyl 4-ethyl-4-[(4-methylsulfonylphenyl)methylcarbamoyl]piperidine-1-carboxylate |
| SMILES | CCC1(C(=O)NCc2ccc(S(C)(=O)=O)cc2)CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C21H32N2O5S/c1-6-21(11-13-23(14-12-21)19(25)28-20(2,3)4)18(24)22-15-16-7-9-17(10-8-16)29(5,26)27/h7-10H,6,11-15H2,1-5H3,(H,22,24) |
| InChIKey | RWOBVCNEPYAJTL-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.56 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |