C20H26N2O3 — CID 150372713
tert-butyl 4-[(4-ethynylbenzoyl)amino]-4-methylpiperidine-1-carboxylate (PubChem CID 150372713) has the molecular formula C20H26N2O3 and a molecular weight of 342.44 g/mol. Its IUPAC name is tert-butyl 4-[(4-ethynylbenzoyl)amino]-4-methylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(4-ethynylbenzoyl)amino]-4-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 150372713 |
| Molecular Formula | C20H26N2O3 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | tert-butyl 4-[(4-ethynylbenzoyl)amino]-4-methylpiperidine-1-carboxylate |
| SMILES | C#Cc1ccc(C(=O)NC2(C)CCN(C(=O)OC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C20H26N2O3/c1-6-15-7-9-16(10-8-15)17(23)21-20(5)11-13-22(14-12-20)18(24)25-19(2,3)4/h1,7-10H,11-14H2,2-5H3,(H,21,23) |
| InChIKey | GYBFSJMBNMWHEK-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|