C20H22Cl2O4 — CID 141491395
butyl 3-(2,4-dichlorophenyl)-2-oxo-1-oxaspiro[4.5]dec-3-ene-4-carboxylate (PubChem CID 141491395) has the molecular formula C20H22Cl2O4 and a molecular weight of 397.30 g/mol. Its IUPAC name is butyl 3-(2,4-dichlorophenyl)-2-oxo-1-oxaspiro[4.5]dec-3-ene-4-carboxylate.
| Compound Name | butyl 3-(2,4-dichlorophenyl)-2-oxo-1-oxaspiro[4.5]dec-3-ene-4-carboxylate |
|---|---|
| PubChem CID | 141491395 |
| Molecular Formula | C20H22Cl2O4 |
| Molecular Weight | 397.30 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | butyl 3-(2,4-dichlorophenyl)-2-oxo-1-oxaspiro[4.5]dec-3-ene-4-carboxylate |
| SMILES | CCCCOC(=O)C1=C(c2ccc(Cl)cc2Cl)C(=O)OC12CCCCC2 |
| InChI | InChI=1S/C20H22Cl2O4/c1-2-3-11-25-19(24)17-16(14-8-7-13(21)12-15(14)22)18(23)26-20(17)9-5-4-6-10-20/h7-8,12H,2-6,9-11H2,1H3 |
| InChIKey | ITEVEXGKCMWKSA-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.30 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|