About (1,6-dimethylcyclohexa-2,4-dien-1-yl) cyclohexanecarboxylate
(1,6-dimethylcyclohexa-2,4-dien-1-yl) cyclohexanecarboxylate (PubChem CID 141493931) has the molecular formula C15H22O2
and a molecular weight of 234.34 g/mol. Its IUPAC name is (1,6-dimethylcyclohexa-2,4-dien-1-yl) cyclohexanecarboxylate.
Analyze (1,6-dimethylcyclohexa-2,4-dien-1-yl) cyclohexanecarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,6-dimethylcyclohexa-2,4-dien-1-yl) cyclohexanecarboxylate?
The IUPAC name of (1,6-dimethylcyclohexa-2,4-dien-1-yl) cyclohexanecarboxylate (CID 141493931) is (1,6-dimethylcyclohexa-2,4-dien-1-yl) cyclohexanecarboxylate.
What is the SMILES notation for (1,6-dimethylcyclohexa-2,4-dien-1-yl) cyclohexanecarboxylate?
The canonical SMILES for (1,6-dimethylcyclohexa-2,4-dien-1-yl) cyclohexanecarboxylate is CC1C=CC=CC1(C)OC(=O)C1CCCCC1.
What is the InChIKey of (1,6-dimethylcyclohexa-2,4-dien-1-yl) cyclohexanecarboxylate?
The InChIKey is RPSSHTMHUNKCFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22O2/c1-12-8-6-7-11-15(12,2)17-14(16)13-9-4-3-5-10-13/h6-8,11-13H,3-5,9-10H2,1-2H3.
What are the key properties of (1,6-dimethylcyclohexa-2,4-dien-1-yl) cyclohexanecarboxylate?
(1,6-dimethylcyclohexa-2,4-dien-1-yl) cyclohexanecarboxylate has a molecular weight of 234.34 g/mol, XLogP of 3.63, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1,6-dimethylcyclohexa-2,4-dien-1-yl) cyclohexanecarboxylate is sourced from PubChem (CID 141493931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).