C14H15F3N2O — CID 141494169
4-[(1-hydroxycyclohexyl)amino]-2-(trifluoromethyl)benzonitrile (PubChem CID 141494169) has the molecular formula C14H15F3N2O and a molecular weight of 284.28 g/mol. Its IUPAC name is 4-[(1-hydroxycyclohexyl)amino]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[(1-hydroxycyclohexyl)amino]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 141494169 |
| Molecular Formula | C14H15F3N2O |
| Molecular Weight | 284.28 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 4-[(1-hydroxycyclohexyl)amino]-2-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1ccc(NC2(O)CCCCC2)cc1C(F)(F)F |
| InChI | InChI=1S/C14H15F3N2O/c15-14(16,17)12-8-11(5-4-10(12)9-18)19-13(20)6-2-1-3-7-13/h4-5,8,19-20H,1-3,6-7H2 |
| InChIKey | RPOVOLHUKSYOPV-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 56.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.28 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|