About 2-pyridin-2-ylethyl 2,6-bis[(4,6-dimethoxy-2-pyridinyl)oxy]benzoate
2-pyridin-2-ylethyl 2,6-bis[(4,6-dimethoxy-2-pyridinyl)oxy]benzoate (PubChem CID 141496169) has the molecular formula C28H27N3O8
and a molecular weight of 533.54 g/mol. Its IUPAC name is 2-pyridin-2-ylethyl 2,6-bis[(4,6-dimethoxy-2-pyridinyl)oxy]benzoate.
Molecular Properties
| Compound Name | 2-pyridin-2-ylethyl 2,6-bis[(4,6-dimethoxy-2-pyridinyl)oxy]benzoate |
| PubChem CID | 141496169 |
| Molecular Formula | C28H27N3O8 |
| Molecular Weight | 533.54 g/mol |
| Exact Mass | 533.18 |
| IUPAC Name | 2-pyridin-2-ylethyl 2,6-bis[(4,6-dimethoxy-2-pyridinyl)oxy]benzoate |
| SMILES | COc1cc(OC)nc(Oc2cccc(Oc3cc(OC)cc(OC)n3)c2C(=O)OCCc2ccccn2)c1 |
| InChI | InChI=1S/C28H27N3O8/c1-33-19-14-23(35-3)30-25(16-19)38-21-9-7-10-22(39-26-17-20(34-2)15-24(31-26)36-4)27(21)28(32)37-13-11-18-8-5-6-12-29-18/h5-10,12,14-17H,11,13H2,1-4H3 |
| InChIKey | HNAFQRNUJUVGPD-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 120.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 533.54 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
Analyze 2-pyridin-2-ylethyl 2,6-bis[(4,6-dimethoxy-2-pyridinyl)oxy]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyridin-2-ylethyl 2,6-bis[(4,6-dimethoxy-2-pyridinyl)oxy]benzoate?
The IUPAC name of 2-pyridin-2-ylethyl 2,6-bis[(4,6-dimethoxy-2-pyridinyl)oxy]benzoate (CID 141496169) is 2-pyridin-2-ylethyl 2,6-bis[(4,6-dimethoxy-2-pyridinyl)oxy]benzoate.
What is the SMILES notation for 2-pyridin-2-ylethyl 2,6-bis[(4,6-dimethoxy-2-pyridinyl)oxy]benzoate?
The canonical SMILES for 2-pyridin-2-ylethyl 2,6-bis[(4,6-dimethoxy-2-pyridinyl)oxy]benzoate is COc1cc(OC)nc(Oc2cccc(Oc3cc(OC)cc(OC)n3)c2C(=O)OCCc2ccccn2)c1.
What is the InChIKey of 2-pyridin-2-ylethyl 2,6-bis[(4,6-dimethoxy-2-pyridinyl)oxy]benzoate?
The InChIKey is HNAFQRNUJUVGPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H27N3O8/c1-33-19-14-23(35-3)30-25(16-19)38-21-9-7-10-22(39-26-17-20(34-2)15-24(31-26)36-4)27(21)28(32)37-13-11-18-8-5-6-12-29-18/h5-10,12,14-17H,11,13H2,1-4H3.
What are the key properties of 2-pyridin-2-ylethyl 2,6-bis[(4,6-dimethoxy-2-pyridinyl)oxy]benzoate?
2-pyridin-2-ylethyl 2,6-bis[(4,6-dimethoxy-2-pyridinyl)oxy]benzoate has a molecular weight of 533.54 g/mol, XLogP of 4.89, 12 rotatable bonds, 0 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyridin-2-ylethyl 2,6-bis[(4,6-dimethoxy-2-pyridinyl)oxy]benzoate is sourced from PubChem (CID 141496169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).