C27H26N4O4 — CID 141498089
N-[4-[[7-hydroxy-3-(4-hydroxyphenyl)quinolin-2-yl]amino]phenyl]-2-morpholin-4-ylacetamide (PubChem CID 141498089) has the molecular formula C27H26N4O4 and a molecular weight of 470.53 g/mol. Its IUPAC name is N-[4-[[7-hydroxy-3-(4-hydroxyphenyl)quinolin-2-yl]amino]phenyl]-2-morpholin-4-ylacetamide.
| Compound Name | N-[4-[[7-hydroxy-3-(4-hydroxyphenyl)quinolin-2-yl]amino]phenyl]-2-morpholin-4-ylacetamide |
|---|---|
| PubChem CID | 141498089 |
| Molecular Formula | C27H26N4O4 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.20 |
| IUPAC Name | N-[4-[[7-hydroxy-3-(4-hydroxyphenyl)quinolin-2-yl]amino]phenyl]-2-morpholin-4-ylacetamide |
| SMILES | O=C(CN1CCOCC1)Nc1ccc(Nc2nc3cc(O)ccc3cc2-c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C27H26N4O4/c32-22-8-1-18(2-9-22)24-15-19-3-10-23(33)16-25(19)30-27(24)29-21-6-4-20(5-7-21)28-26(34)17-31-11-13-35-14-12-31/h1-10,15-16,32-33H,11-14,17H2,(H,28,34)(H,29,30) |
| InChIKey | ZXIGHWRKZNMJSZ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 106.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |