C7H10N2O3 — CID 141499533
prop-2-enamide;pyrrolidine-2,5-dione (PubChem CID 141499533) has the molecular formula C7H10N2O3 and a molecular weight of 170.17 g/mol. Its IUPAC name is prop-2-enamide;pyrrolidine-2,5-dione.
| Compound Name | prop-2-enamide;pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 141499533 |
| Molecular Formula | C7H10N2O3 |
| Molecular Weight | 170.17 g/mol |
| Exact Mass | 170.07 |
| IUPAC Name | prop-2-enamide;pyrrolidine-2,5-dione |
| SMILES | C=CC(N)=O.O=C1CCC(=O)N1 |
| InChI | InChI=1S/C4H5NO2.C3H5NO/c6-3-1-2-4(7)5-3;1-2-3(4)5/h1-2H2,(H,5,6,7);2H,1H2,(H2,4,5) |
| InChIKey | KRWRHQQOGIYTNX-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.17 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|