C9H15NO2 — CID 157322302
ethene;prop-1-ene;pyrrolidine-2,5-dione (PubChem CID 157322302) has the molecular formula C9H15NO2 and a molecular weight of 169.22 g/mol. Its IUPAC name is ethene;prop-1-ene;pyrrolidine-2,5-dione.
| Compound Name | ethene;prop-1-ene;pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 157322302 |
| Molecular Formula | C9H15NO2 |
| Molecular Weight | 169.22 g/mol |
| Exact Mass | 169.11 |
| IUPAC Name | ethene;prop-1-ene;pyrrolidine-2,5-dione |
| SMILES | C=C.C=CC.O=C1CCC(=O)N1 |
| InChI | InChI=1S/C4H5NO2.C3H6.C2H4/c6-3-1-2-4(7)5-3;1-3-2;1-2/h1-2H2,(H,5,6,7);3H,1H2,2H3;1-2H2 |
| InChIKey | BEHSMNXIWWWOJK-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.22 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|