C17H11NO — CID 14150034
5-carbazol-9-ylpenta-2,4-diyn-1-ol (PubChem CID 14150034) has the molecular formula C17H11NO and a molecular weight of 245.28 g/mol. Its IUPAC name is 5-carbazol-9-ylpenta-2,4-diyn-1-ol.
| Compound Name | 5-carbazol-9-ylpenta-2,4-diyn-1-ol |
|---|---|
| PubChem CID | 14150034 |
| Molecular Formula | C17H11NO |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | 5-carbazol-9-ylpenta-2,4-diyn-1-ol |
| SMILES | OCC#CC#Cn1c2ccccc2c2ccccc21 |
| InChI | InChI=1S/C17H11NO/c19-13-7-1-6-12-18-16-10-4-2-8-14(16)15-9-3-5-11-17(15)18/h2-5,8-11,19H,13H2 |
| InChIKey | AXQBOJZKGSBYJZ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|