carbazole-9-carbonyl fluoride

C13H8FNO — CID 45082000

IUPACcarbazole-9-carbonyl fluoride
SMILESO=C(F)n1c2ccccc2c2ccccc21
InChIInChI=1S/C13H8FNO/c14-13(16)15-11-7-3-1-5-9(11)10-6-2-4-8-12(10)15/h1-8H
InChIKeyKNZQMVKAGCFHGH-UHFFFAOYSA-N
MW213.21 g/mol
LogP3.73
Rot. Bonds

About carbazole-9-carbonyl fluoride

carbazole-9-carbonyl fluoride (PubChem CID 45082000) has the molecular formula C13H8FNO and a molecular weight of 213.21 g/mol. Its IUPAC name is carbazole-9-carbonyl fluoride.

Molecular Properties

Compound Namecarbazole-9-carbonyl fluoride
PubChem CID45082000
Molecular FormulaC13H8FNO
Molecular Weight213.21 g/mol
Exact Mass213.06
IUPAC Namecarbazole-9-carbonyl fluoride
SMILESO=C(F)n1c2ccccc2c2ccccc21
InChIInChI=1S/C13H8FNO/c14-13(16)15-11-7-3-1-5-9(11)10-6-2-4-8-12(10)15/h1-8H
InChIKeyKNZQMVKAGCFHGH-UHFFFAOYSA-N
XLogP3.73
TPSA22.00 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500213.21
LogP ≤ 53.73
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze carbazole-9-carbonyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of carbazole-9-carbonyl fluoride?
The IUPAC name of carbazole-9-carbonyl fluoride (CID 45082000) is carbazole-9-carbonyl fluoride.
What is the SMILES notation for carbazole-9-carbonyl fluoride?
The canonical SMILES for carbazole-9-carbonyl fluoride is O=C(F)n1c2ccccc2c2ccccc21.
What is the InChIKey of carbazole-9-carbonyl fluoride?
The InChIKey is KNZQMVKAGCFHGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8FNO/c14-13(16)15-11-7-3-1-5-9(11)10-6-2-4-8-12(10)15/h1-8H.
What are the key properties of carbazole-9-carbonyl fluoride?
carbazole-9-carbonyl fluoride has a molecular weight of 213.21 g/mol, XLogP of 3.73, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for carbazole-9-carbonyl fluoride is sourced from PubChem (CID 45082000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).