About carbazole-9-carbonyl fluoride
carbazole-9-carbonyl fluoride (PubChem CID 45082000) has the molecular formula C13H8FNO
and a molecular weight of 213.21 g/mol. Its IUPAC name is carbazole-9-carbonyl fluoride.
Molecular Properties
| Compound Name | carbazole-9-carbonyl fluoride |
| PubChem CID | 45082000 |
| Molecular Formula | C13H8FNO |
| Molecular Weight | 213.21 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | carbazole-9-carbonyl fluoride |
| SMILES | O=C(F)n1c2ccccc2c2ccccc21 |
| InChI | InChI=1S/C13H8FNO/c14-13(16)15-11-7-3-1-5-9(11)10-6-2-4-8-12(10)15/h1-8H |
| InChIKey | KNZQMVKAGCFHGH-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.21 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze carbazole-9-carbonyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbazole-9-carbonyl fluoride?
The IUPAC name of carbazole-9-carbonyl fluoride (CID 45082000) is carbazole-9-carbonyl fluoride.
What is the SMILES notation for carbazole-9-carbonyl fluoride?
The canonical SMILES for carbazole-9-carbonyl fluoride is O=C(F)n1c2ccccc2c2ccccc21.
What is the InChIKey of carbazole-9-carbonyl fluoride?
The InChIKey is KNZQMVKAGCFHGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8FNO/c14-13(16)15-11-7-3-1-5-9(11)10-6-2-4-8-12(10)15/h1-8H.
What are the key properties of carbazole-9-carbonyl fluoride?
carbazole-9-carbonyl fluoride has a molecular weight of 213.21 g/mol, XLogP of 3.73, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for carbazole-9-carbonyl fluoride is sourced from PubChem (CID 45082000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).