C10H12N2O2 — CID 14150050
N,N'-hexa-2,4-diyne-1,6-diyldiacetamide (PubChem CID 14150050) has the molecular formula C10H12N2O2 and a molecular weight of 192.21 g/mol. Its IUPAC name is N-(6-acetamidohexa-2,4-diynyl)acetamide.
| Compound Name | N,N'-hexa-2,4-diyne-1,6-diyldiacetamide |
|---|---|
| PubChem CID | 14150050 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | N-(6-acetamidohexa-2,4-diynyl)acetamide |
| SMILES | CC(=O)NCC#CC#CCNC(=O)C |
| InChI | InChI=1S/C10H12N2O2/c1-9(13)11-7-5-3-4-6-8-12-10(2)14/h7-8H2,1-2H3,(H,11,13)(H,12,14) |
| InChIKey | FRIJYOLUYSXHRS-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | 309 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|