C8H12N2O2 — CID 315402
N,N'-diethylbut-2-ynediamide (PubChem CID 315402) has the molecular formula C8H12N2O2 and a molecular weight of 168.19 g/mol. Its IUPAC name is N,N'-diethylbut-2-ynediamide.
| Compound Name | N,N'-diethylbut-2-ynediamide |
|---|---|
| PubChem CID | 315402 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | N,N'-diethylbut-2-ynediamide |
| SMILES | CCNC(=O)C#CC(=O)NCC |
| InChI | InChI=1S/C8H12N2O2/c1-3-9-7(11)5-6-8(12)10-4-2/h3-4H2,1-2H3,(H,9,11)(H,10,12) |
| InChIKey | AAHUADQYRSMRMP-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | 212 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|