C19H15F2NO2S — CID 14154406
2-[2-[4-(3,5-difluorophenoxy)phenoxy]ethylsulfanyl]pyridine (PubChem CID 14154406) has the molecular formula C19H15F2NO2S and a molecular weight of 359.40 g/mol. Its IUPAC name is 2-[2-[4-(3,5-difluorophenoxy)phenoxy]ethylsulfanyl]pyridine.
| Compound Name | 2-[2-[4-(3,5-difluorophenoxy)phenoxy]ethylsulfanyl]pyridine |
|---|---|
| PubChem CID | 14154406 |
| Molecular Formula | C19H15F2NO2S |
| Molecular Weight | 359.40 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | 2-[2-[4-(3,5-difluorophenoxy)phenoxy]ethylsulfanyl]pyridine |
| SMILES | Fc1cc(F)cc(Oc2ccc(OCCSc3ccccn3)cc2)c1 |
| InChI | InChI=1S/C19H15F2NO2S/c20-14-11-15(21)13-18(12-14)24-17-6-4-16(5-7-17)23-9-10-25-19-3-1-2-8-22-19/h1-8,11-13H,9-10H2 |
| InChIKey | SJNCCJRAGZUAGE-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.40 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|