C13H19NO3 — CID 14171875
tert-butyl 3-formyl-2,4-dimethyl-4H-pyridine-1-carboxylate (PubChem CID 14171875) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is tert-butyl 3-formyl-2,4-dimethyl-4H-pyridine-1-carboxylate.
| Compound Name | tert-butyl 3-formyl-2,4-dimethyl-4H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 14171875 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | tert-butyl 3-formyl-2,4-dimethyl-4H-pyridine-1-carboxylate |
| SMILES | CC1=C(C=O)C(C)C=CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H19NO3/c1-9-6-7-14(10(2)11(9)8-15)12(16)17-13(3,4)5/h6-9H,1-5H3 |
| InChIKey | IMYVFACGYNGVTI-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|