C17H24N2O2 — CID 14187810
ethyl (2E,4E)-3-methyl-5-[5-methyl-1-(3-methylbut-2-enyl)imidazol-4-yl]penta-2,4-dienoate (PubChem CID 14187810) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is ethyl (2E,4E)-3-methyl-5-[5-methyl-1-(3-methylbut-2-enyl)imidazol-4-yl]penta-2,4-dienoate.
| Compound Name | ethyl (2E,4E)-3-methyl-5-[5-methyl-1-(3-methylbut-2-enyl)imidazol-4-yl]penta-2,4-dienoate |
|---|---|
| PubChem CID | 14187810 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | ethyl (2E,4E)-3-methyl-5-[5-methyl-1-(3-methylbut-2-enyl)imidazol-4-yl]penta-2,4-dienoate |
| SMILES | CCOC(=O)/C=C(C)/C=C/c1ncn(CC=C(C)C)c1C |
| InChI | InChI=1S/C17H24N2O2/c1-6-21-17(20)11-14(4)7-8-16-15(5)19(12-18-16)10-9-13(2)3/h7-9,11-12H,6,10H2,1-5H3/b8-7+,14-11+ |
| InChIKey | YTQBHLUTOVGMRN-DQBULIGTSA-N |
| XLogP | 3.68 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|