C15H22N5O+ — CID 142000998
(4-carbamoyl-2-methanimidoylphenyl)-[2-(2,3,4,5-tetrahydropyridin-6-ylamino)ethyl]azanium (PubChem CID 142000998) has the molecular formula C15H22N5O+ and a molecular weight of 288.38 g/mol. Its IUPAC name is (4-carbamoyl-2-methanimidoylphenyl)-[2-(2,3,4,5-tetrahydropyridin-6-ylamino)ethyl]azanium.
| Compound Name | (4-carbamoyl-2-methanimidoylphenyl)-[2-(2,3,4,5-tetrahydropyridin-6-ylamino)ethyl]azanium |
|---|---|
| PubChem CID | 142000998 |
| Molecular Formula | C15H22N5O+ |
| Molecular Weight | 288.38 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | (4-carbamoyl-2-methanimidoylphenyl)-[2-(2,3,4,5-tetrahydropyridin-6-ylamino)ethyl]azanium |
| SMILES | [H]/N=C/c1cc(C(N)=O)ccc1[NH2+]CCNC1=NCCCC1 |
| InChI | InChI=1S/C15H21N5O/c16-10-12-9-11(15(17)21)4-5-13(12)18-7-8-20-14-3-1-2-6-19-14/h4-5,9-10,16,18H,1-3,6-8H2,(H2,17,21)(H,19,20)/p+1/b16-10+ |
| InChIKey | ZMNALRFGBCTLRG-MHWRWJLKSA-O |
| XLogP | 0.15 |
| TPSA | 107.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.38 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|