C16H23N5O — CID 142103618
3-(methylamino)-4-[3-(2,3,4,5-tetrahydropyridin-6-ylamino)propanimidoyl]benzamide (PubChem CID 142103618) has the molecular formula C16H23N5O and a molecular weight of 301.39 g/mol. Its IUPAC name is 3-(methylamino)-4-[3-(2,3,4,5-tetrahydropyridin-6-ylamino)propanimidoyl]benzamide.
| Compound Name | 3-(methylamino)-4-[3-(2,3,4,5-tetrahydropyridin-6-ylamino)propanimidoyl]benzamide |
|---|---|
| PubChem CID | 142103618 |
| Molecular Formula | C16H23N5O |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.19 |
| IUPAC Name | 3-(methylamino)-4-[3-(2,3,4,5-tetrahydropyridin-6-ylamino)propanimidoyl]benzamide |
| SMILES | [H]/N=C(\CCNC1=NCCCC1)c1ccc(C(N)=O)cc1NC |
| InChI | InChI=1S/C16H23N5O/c1-19-14-10-11(16(18)22)5-6-12(14)13(17)7-9-21-15-4-2-3-8-20-15/h5-6,10,17,19H,2-4,7-9H2,1H3,(H2,18,22)(H,20,21)/b17-13+ |
| InChIKey | YGNHCOACRXKGNV-GHRIWEEISA-N |
| XLogP | 1.76 |
| TPSA | 103.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|