C21H15F3N2O — CID 142003587
(E)-N-(4-methanimidoylnaphthalen-1-yl)-3-[3-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 142003587) has the molecular formula C21H15F3N2O and a molecular weight of 368.36 g/mol. Its IUPAC name is (E)-N-(4-methanimidoylnaphthalen-1-yl)-3-[3-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-(4-methanimidoylnaphthalen-1-yl)-3-[3-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 142003587 |
| Molecular Formula | C21H15F3N2O |
| Molecular Weight | 368.36 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | (E)-N-(4-methanimidoylnaphthalen-1-yl)-3-[3-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | [H]/N=C/c1ccc(NC(=O)/C=C/c2cccc(C(F)(F)F)c2)c2ccccc12 |
| InChI | InChI=1S/C21H15F3N2O/c22-21(23,24)16-5-3-4-14(12-16)8-11-20(27)26-19-10-9-15(13-25)17-6-1-2-7-18(17)19/h1-13,25H,(H,26,27)/b11-8+,25-13+ |
| InChIKey | SMFASIJRQJXFNK-KHPHFDLQSA-N |
| XLogP | 5.51 |
| TPSA | 52.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.36 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|