C29H31N5O — CID 142006372
3-[4-[4-(6-methoxyquinolin-5-yl)piperazin-1-yl]cyclohexyl]-1H-indole-5-carbonitrile (PubChem CID 142006372) has the molecular formula C29H31N5O and a molecular weight of 465.60 g/mol. Its IUPAC name is 3-[4-[4-(6-methoxyquinolin-5-yl)piperazin-1-yl]cyclohexyl]-1H-indole-5-carbonitrile.
| Compound Name | 3-[4-[4-(6-methoxyquinolin-5-yl)piperazin-1-yl]cyclohexyl]-1H-indole-5-carbonitrile |
|---|---|
| PubChem CID | 142006372 |
| Molecular Formula | C29H31N5O |
| Molecular Weight | 465.60 g/mol |
| Exact Mass | 465.25 |
| IUPAC Name | 3-[4-[4-(6-methoxyquinolin-5-yl)piperazin-1-yl]cyclohexyl]-1H-indole-5-carbonitrile |
| SMILES | COc1ccc2ncccc2c1N1CCN(C2CCC(c3c[nH]c4ccc(C#N)cc34)CC2)CC1 |
| InChI | InChI=1S/C29H31N5O/c1-35-28-11-10-26-23(3-2-12-31-26)29(28)34-15-13-33(14-16-34)22-7-5-21(6-8-22)25-19-32-27-9-4-20(18-30)17-24(25)27/h2-4,9-12,17,19,21-22,32H,5-8,13-16H2,1H3 |
| InChIKey | PFRWPZZKSUIGLD-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.60 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |