C15H19N3O2S — CID 142006952
4-ethyl-N-(4-nitro-5,6,7,8-tetrahydronaphthalen-1-yl)-4,5-dihydro-1,3-thiazol-2-amine (PubChem CID 142006952) has the molecular formula C15H19N3O2S and a molecular weight of 305.40 g/mol. Its IUPAC name is 4-ethyl-N-(4-nitro-5,6,7,8-tetrahydronaphthalen-1-yl)-4,5-dihydro-1,3-thiazol-2-amine.
| Compound Name | 4-ethyl-N-(4-nitro-5,6,7,8-tetrahydronaphthalen-1-yl)-4,5-dihydro-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 142006952 |
| Molecular Formula | C15H19N3O2S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 4-ethyl-N-(4-nitro-5,6,7,8-tetrahydronaphthalen-1-yl)-4,5-dihydro-1,3-thiazol-2-amine |
| SMILES | CCC1CSC(Nc2ccc([N+](=O)[O-])c3c2CCCC3)=N1 |
| InChI | InChI=1S/C15H19N3O2S/c1-2-10-9-21-15(16-10)17-13-7-8-14(18(19)20)12-6-4-3-5-11(12)13/h7-8,10H,2-6,9H2,1H3,(H,16,17) |
| InChIKey | DPMFWSXMBQFNNB-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 67.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|