About N'-cyano-4-phenylpiperazine-1-carboximidamide;ethene
N'-cyano-4-phenylpiperazine-1-carboximidamide;ethene (PubChem CID 142010836) has the molecular formula C14H19N5
and a molecular weight of 257.34 g/mol. Its IUPAC name is N'-cyano-4-phenylpiperazine-1-carboximidamide;ethene.
Molecular Properties
| Compound Name | N'-cyano-4-phenylpiperazine-1-carboximidamide;ethene |
| PubChem CID | 142010836 |
| Molecular Formula | C14H19N5 |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | N'-cyano-4-phenylpiperazine-1-carboximidamide;ethene |
| SMILES | C=C.N#C/N=C(\N)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C12H15N5.C2H4/c13-10-15-12(14)17-8-6-16(7-9-17)11-4-2-1-3-5-11;1-2/h1-5H,6-9H2,(H2,14,15);1-2H2 |
| InChIKey | AWKRVEFIXCCVFG-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N'-cyano-4-phenylpiperazine-1-carboximidamide;ethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-cyano-4-phenylpiperazine-1-carboximidamide;ethene?
The IUPAC name of N'-cyano-4-phenylpiperazine-1-carboximidamide;ethene (CID 142010836) is N'-cyano-4-phenylpiperazine-1-carboximidamide;ethene.
What is the SMILES notation for N'-cyano-4-phenylpiperazine-1-carboximidamide;ethene?
The canonical SMILES for N'-cyano-4-phenylpiperazine-1-carboximidamide;ethene is C=C.N#C/N=C(\N)N1CCN(c2ccccc2)CC1.
What is the InChIKey of N'-cyano-4-phenylpiperazine-1-carboximidamide;ethene?
The InChIKey is AWKRVEFIXCCVFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N5.C2H4/c13-10-15-12(14)17-8-6-16(7-9-17)11-4-2-1-3-5-11;1-2/h1-5H,6-9H2,(H2,14,15);1-2H2.
What are the key properties of N'-cyano-4-phenylpiperazine-1-carboximidamide;ethene?
N'-cyano-4-phenylpiperazine-1-carboximidamide;ethene has a molecular weight of 257.34 g/mol, XLogP of 1.41, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-cyano-4-phenylpiperazine-1-carboximidamide;ethene is sourced from PubChem (CID 142010836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).