C29H35F2N5O4 — CID 142011007
acetylene;3,5-difluoro-N-[N'-(4-methoxyphenyl)carbamimidoyl]benzamide;1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-2-one (PubChem CID 142011007) has the molecular formula C29H35F2N5O4 and a molecular weight of 555.63 g/mol. Its IUPAC name is acetylene;3,5-difluoro-N-[N'-(4-methoxyphenyl)carbamimidoyl]benzamide;1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-2-one.
| Compound Name | acetylene;3,5-difluoro-N-[N'-(4-methoxyphenyl)carbamimidoyl]benzamide;1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-2-one |
|---|---|
| PubChem CID | 142011007 |
| Molecular Formula | C29H35F2N5O4 |
| Molecular Weight | 555.63 g/mol |
| Exact Mass | 555.27 |
| IUPAC Name | acetylene;3,5-difluoro-N-[N'-(4-methoxyphenyl)carbamimidoyl]benzamide;1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-2-one |
| SMILES | C#C.COc1ccc(/N=C(\N)NC(=O)c2cc(F)cc(F)c2)cc1.O=C(CN1CCCCCC1=O)N1CCCC1 |
| InChI | InChI=1S/C15H13F2N3O2.C12H20N2O2.C2H2/c1-22-13-4-2-12(3-5-13)19-15(18)20-14(21)9-6-10(16)8-11(17)7-9;15-11-6-2-1-3-9-14(11)10-12(16)13-7-4-5-8-13;1-2/h2-8H,1H3,(H3,18,19,20,21);1-10H2;1-2H |
| InChIKey | LMNVGUCJZPKOCJ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 117.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.63 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|