C23H32N6O3 — CID 142011669
acetylene;1-cyano-2-(3-methylphenyl)guanidine;1-[2-(3-hydroxypyrrolidin-1-yl)-2-oxoethyl]azepan-2-one (PubChem CID 142011669) has the molecular formula C23H32N6O3 and a molecular weight of 440.55 g/mol. Its IUPAC name is acetylene;1-cyano-2-(3-methylphenyl)guanidine;1-[2-(3-hydroxypyrrolidin-1-yl)-2-oxoethyl]azepan-2-one.
| Compound Name | acetylene;1-cyano-2-(3-methylphenyl)guanidine;1-[2-(3-hydroxypyrrolidin-1-yl)-2-oxoethyl]azepan-2-one |
|---|---|
| PubChem CID | 142011669 |
| Molecular Formula | C23H32N6O3 |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.25 |
| IUPAC Name | acetylene;1-cyano-2-(3-methylphenyl)guanidine;1-[2-(3-hydroxypyrrolidin-1-yl)-2-oxoethyl]azepan-2-one |
| SMILES | C#C.Cc1cccc(/N=C(\N)NC#N)c1.O=C1CCCCCN1CC(=O)N1CCC(O)C1 |
| InChI | InChI=1S/C12H20N2O3.C9H10N4.C2H2/c15-10-5-7-14(8-10)12(17)9-13-6-3-1-2-4-11(13)16;1-7-3-2-4-8(5-7)13-9(11)12-6-10;1-2/h10,15H,1-9H2;2-5H,1H3,(H3,11,12,13);1-2H |
| InChIKey | WJYPFXPNUKEVDU-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 135.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|