C23H33N7O2 — CID 142011399
acetylene;1-cyano-2-[3-(methylamino)phenyl]guanidine;1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-2-one (PubChem CID 142011399) has the molecular formula C23H33N7O2 and a molecular weight of 439.56 g/mol. Its IUPAC name is acetylene;1-cyano-2-[3-(methylamino)phenyl]guanidine;1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-2-one.
| Compound Name | acetylene;1-cyano-2-[3-(methylamino)phenyl]guanidine;1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-2-one |
|---|---|
| PubChem CID | 142011399 |
| Molecular Formula | C23H33N7O2 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.27 |
| IUPAC Name | acetylene;1-cyano-2-[3-(methylamino)phenyl]guanidine;1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-2-one |
| SMILES | C#C.CNc1cccc(/N=C(\N)NC#N)c1.O=C(CN1CCCCCC1=O)N1CCCC1 |
| InChI | InChI=1S/C12H20N2O2.C9H11N5.C2H2/c15-11-6-2-1-3-9-14(11)10-12(16)13-7-4-5-8-13;1-12-7-3-2-4-8(5-7)14-9(11)13-6-10;1-2/h1-10H2;2-5,12H,1H3,(H3,11,13,14);1-2H |
| InChIKey | FPOYYENGCFULHE-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 126.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|