C33H38N8O6 — CID 142011491
acetylene;benzyl N-[(4Z)-4-hydroxyimino-1-[2-(2-oxoazepan-1-yl)acetyl]pyrrolidin-3-yl]carbamate;1-cyano-2-(2-methyl-1-benzofuran-5-yl)guanidine (PubChem CID 142011491) has the molecular formula C33H38N8O6 and a molecular weight of 642.72 g/mol. Its IUPAC name is acetylene;benzyl N-[(4Z)-4-hydroxyimino-1-[2-(2-oxoazepan-1-yl)acetyl]pyrrolidin-3-yl]carbamate;1-cyano-2-(2-methyl-1-benzofuran-5-yl)guanidine.
| Compound Name | acetylene;benzyl N-[(4Z)-4-hydroxyimino-1-[2-(2-oxoazepan-1-yl)acetyl]pyrrolidin-3-yl]carbamate;1-cyano-2-(2-methyl-1-benzofuran-5-yl)guanidine |
|---|---|
| PubChem CID | 142011491 |
| Molecular Formula | C33H38N8O6 |
| Molecular Weight | 642.72 g/mol |
| Exact Mass | 642.29 |
| IUPAC Name | acetylene;benzyl N-[(4Z)-4-hydroxyimino-1-[2-(2-oxoazepan-1-yl)acetyl]pyrrolidin-3-yl]carbamate;1-cyano-2-(2-methyl-1-benzofuran-5-yl)guanidine |
| SMILES | C#C.Cc1cc2cc(/N=C(\N)NC#N)ccc2o1.O=C(NC1CN(C(=O)CN2CCCCCC2=O)C/C1=N/O)OCc1ccccc1 |
| InChI | InChI=1S/C20H26N4O5.C11H10N4O.C2H2/c25-18-9-5-2-6-10-23(18)13-19(26)24-11-16(17(12-24)22-28)21-20(27)29-14-15-7-3-1-4-8-15;1-7-4-8-5-9(2-3-10(8)16-7)15-11(13)14-6-12;1-2/h1,3-4,7-8,16,28H,2,5-6,9-14H2,(H,21,27);2-5H,1H3,(H3,13,14,15);1-2H/b22-17-;; |
| InChIKey | LKYCKTAFEUQZLR-BBFBTWSBSA-N |
| XLogP | 3.36 |
| TPSA | 198.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.72 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'} |
|---|