C28H30N6O4 — CID 142011730
2-[3-[(E)-[N-cyano-N'-(2-methyl-1-benzofuran-5-yl)carbamimidoyl]iminomethyl]-2-oxoazepan-1-yl]-N-[2-(4-hydroxyphenyl)ethyl]acetamide (PubChem CID 142011730) has the molecular formula C28H30N6O4 and a molecular weight of 514.59 g/mol. Its IUPAC name is 2-[3-[(E)-[N-cyano-N'-(2-methyl-1-benzofuran-5-yl)carbamimidoyl]iminomethyl]-2-oxoazepan-1-yl]-N-[2-(4-hydroxyphenyl)ethyl]acetamide.
| Compound Name | 2-[3-[(E)-[N-cyano-N'-(2-methyl-1-benzofuran-5-yl)carbamimidoyl]iminomethyl]-2-oxoazepan-1-yl]-N-[2-(4-hydroxyphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 142011730 |
| Molecular Formula | C28H30N6O4 |
| Molecular Weight | 514.59 g/mol |
| Exact Mass | 514.23 |
| IUPAC Name | 2-[3-[(E)-[N-cyano-N'-(2-methyl-1-benzofuran-5-yl)carbamimidoyl]iminomethyl]-2-oxoazepan-1-yl]-N-[2-(4-hydroxyphenyl)ethyl]acetamide |
| SMILES | Cc1cc2cc(/N=C(/N=C/C3CCCCN(CC(=O)NCCc4ccc(O)cc4)C3=O)NC#N)ccc2o1 |
| InChI | InChI=1S/C28H30N6O4/c1-19-14-22-15-23(7-10-25(22)38-19)33-28(32-18-29)31-16-21-4-2-3-13-34(27(21)37)17-26(36)30-12-11-20-5-8-24(35)9-6-20/h5-10,14-16,21,35H,2-4,11-13,17H2,1H3,(H,30,36)(H,32,33)/b31-16+ |
| InChIKey | HPPWKNUXPSTIRX-WCMJOSRZSA-N |
| XLogP | 3.56 |
| TPSA | 143.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.59 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|