C31H35ClN6O4 — CID 142011741
N-[3-(3-chloro-4-methoxyphenyl)propyl]-2-[3-[(Z)-[N-cyano-N'-(2-methyl-1-benzofuran-5-yl)carbamimidoyl]iminomethyl]-2-oxoazepan-1-yl]-N-methylacetamide (PubChem CID 142011741) has the molecular formula C31H35ClN6O4 and a molecular weight of 591.11 g/mol. Its IUPAC name is N-[3-(3-chloro-4-methoxyphenyl)propyl]-2-[3-[(Z)-[N-cyano-N'-(2-methyl-1-benzofuran-5-yl)carbamimidoyl]iminomethyl]-2-oxoazepan-1-yl]-N-methylacetamide.
| Compound Name | N-[3-(3-chloro-4-methoxyphenyl)propyl]-2-[3-[(Z)-[N-cyano-N'-(2-methyl-1-benzofuran-5-yl)carbamimidoyl]iminomethyl]-2-oxoazepan-1-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 142011741 |
| Molecular Formula | C31H35ClN6O4 |
| Molecular Weight | 591.11 g/mol |
| Exact Mass | 590.24 |
| IUPAC Name | N-[3-(3-chloro-4-methoxyphenyl)propyl]-2-[3-[(Z)-[N-cyano-N'-(2-methyl-1-benzofuran-5-yl)carbamimidoyl]iminomethyl]-2-oxoazepan-1-yl]-N-methylacetamide |
| SMILES | COc1ccc(CCCN(C)C(=O)CN2CCCCC(/C=N\C(=N\c3ccc4oc(C)cc4c3)NC#N)C2=O)cc1Cl |
| InChI | InChI=1S/C31H35ClN6O4/c1-21-15-24-17-25(10-12-27(24)42-21)36-31(35-20-33)34-18-23-8-4-5-14-38(30(23)40)19-29(39)37(2)13-6-7-22-9-11-28(41-3)26(32)16-22/h9-12,15-18,23H,4-8,13-14,19H2,1-3H3,(H,35,36)/b34-18- |
| InChIKey | CQSHFTQIWWYESG-HQDYHJHZSA-N |
| XLogP | 5.25 |
| TPSA | 123.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.11 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|