C10H12N6 — CID 142011371
1-cyano-2-(2-methyl-1,8a-dihydroimidazo[1,2-a]pyridin-6-yl)guanidine (PubChem CID 142011371) has the molecular formula C10H12N6 and a molecular weight of 216.25 g/mol. Its IUPAC name is 1-cyano-2-(2-methyl-1,8a-dihydroimidazo[1,2-a]pyridin-6-yl)guanidine.
| Compound Name | 1-cyano-2-(2-methyl-1,8a-dihydroimidazo[1,2-a]pyridin-6-yl)guanidine |
|---|---|
| PubChem CID | 142011371 |
| Molecular Formula | C10H12N6 |
| Molecular Weight | 216.25 g/mol |
| Exact Mass | 216.11 |
| IUPAC Name | 1-cyano-2-(2-methyl-1,8a-dihydroimidazo[1,2-a]pyridin-6-yl)guanidine |
| SMILES | CC1=CN2C=C(/N=C(\N)NC#N)C=CC2N1 |
| InChI | InChI=1S/C10H12N6/c1-7-4-16-5-8(2-3-9(16)14-7)15-10(12)13-6-11/h2-5,9,14H,1H3,(H3,12,13,15) |
| InChIKey | SRTDIVIWLKIJNJ-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 89.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.25 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|