C15H23N4+ — CID 123392654
(N-hexa-2,4-dien-3-yl-N'-methylcarbamimidoyl)-methylidene-(1-methyl-2H-pyridin-5-yl)azanium (PubChem CID 123392654) has the molecular formula C15H23N4+ and a molecular weight of 259.38 g/mol. Its IUPAC name is (N-hexa-2,4-dien-3-yl-N'-methylcarbamimidoyl)-methylidene-(1-methyl-2H-pyridin-5-yl)azanium.
| Compound Name | (N-hexa-2,4-dien-3-yl-N'-methylcarbamimidoyl)-methylidene-(1-methyl-2H-pyridin-5-yl)azanium |
|---|---|
| PubChem CID | 123392654 |
| Molecular Formula | C15H23N4+ |
| Molecular Weight | 259.38 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | (N-hexa-2,4-dien-3-yl-N'-methylcarbamimidoyl)-methylidene-(1-methyl-2H-pyridin-5-yl)azanium |
| SMILES | C=[N+](C1=CN(C)CC=C1)/C(=N/C)NC(C=CC)=CC |
| InChI | InChI=1S/C15H23N4/c1-6-9-13(7-2)17-15(16-3)19(5)14-10-8-11-18(4)12-14/h6-10,12H,5,11H2,1-4H3,(H,16,17)/q+1 |
| InChIKey | HPWSMYVICYEEGT-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 30.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.38 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|