C16H29N3 — CID 143449242
ethane;1-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-N-methyl-4H-pyrimidin-4-amine (PubChem CID 143449242) has the molecular formula C16H29N3 and a molecular weight of 263.43 g/mol. Its IUPAC name is ethane;1-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-N-methyl-4H-pyrimidin-4-amine.
| Compound Name | ethane;1-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-N-methyl-4H-pyrimidin-4-amine |
|---|---|
| PubChem CID | 143449242 |
| Molecular Formula | C16H29N3 |
| Molecular Weight | 263.43 g/mol |
| Exact Mass | 263.24 |
| IUPAC Name | ethane;1-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-N-methyl-4H-pyrimidin-4-amine |
| SMILES | C=C/C=C\C=C(/C)N1C=CC(NC)N=C1.CC.CC |
| InChI | InChI=1S/C12H17N3.2C2H6/c1-4-5-6-7-11(2)15-9-8-12(13-3)14-10-15;2*1-2/h4-10,12-13H,1H2,2-3H3;2*1-2H3/b6-5-,11-7+;; |
| InChIKey | QHXDBEWBHIJJRB-BHXAJJCLSA-N |
| XLogP | 4.09 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.43 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|