C26H42N2O4 — CID 142011980
3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan;4,4-dimethylpentanenitrile;(3-hydroxy-1-phenylpentan-2-yl)carbamic acid (PubChem CID 142011980) has the molecular formula C26H42N2O4 and a molecular weight of 446.63 g/mol. Its IUPAC name is 3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan;4,4-dimethylpentanenitrile;(3-hydroxy-1-phenylpentan-2-yl)carbamic acid.
| Compound Name | 3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan;4,4-dimethylpentanenitrile;(3-hydroxy-1-phenylpentan-2-yl)carbamic acid |
|---|---|
| PubChem CID | 142011980 |
| Molecular Formula | C26H42N2O4 |
| Molecular Weight | 446.63 g/mol |
| Exact Mass | 446.31 |
| IUPAC Name | 3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan;4,4-dimethylpentanenitrile;(3-hydroxy-1-phenylpentan-2-yl)carbamic acid |
| SMILES | C1CC2CCOC2C1.CC(C)(C)CCC#N.CCC(O)C(Cc1ccccc1)NC(=O)O |
| InChI | InChI=1S/C12H17NO3.C7H13N.C7H12O/c1-2-11(14)10(13-12(15)16)8-9-6-4-3-5-7-9;1-7(2,3)5-4-6-8;1-2-6-4-5-8-7(6)3-1/h3-7,10-11,13-14H,2,8H2,1H3,(H,15,16);4-5H2,1-3H3;6-7H,1-5H2 |
| InChIKey | XFVRSGDEXUQTSZ-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 102.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.63 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |