C30H40N4O7S — CID 69313921
[(3aR,4S,6aS)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3R)-4-(3-aminophenyl)sulfonyl-4-[(4-cyano-2,2-dimethylbutyl)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate (PubChem CID 69313921) has the molecular formula C30H40N4O7S and a molecular weight of 600.74 g/mol. Its IUPAC name is [(3aR,4S,6aS)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3R)-4-(3-aminophenyl)sulfonyl-4-[(4-cyano-2,2-dimethylbutyl)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate.
| Compound Name | [(3aR,4S,6aS)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3R)-4-(3-aminophenyl)sulfonyl-4-[(4-cyano-2,2-dimethylbutyl)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 69313921 |
| Molecular Formula | C30H40N4O7S |
| Molecular Weight | 600.74 g/mol |
| Exact Mass | 600.26 |
| IUPAC Name | [(3aR,4S,6aS)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3R)-4-(3-aminophenyl)sulfonyl-4-[(4-cyano-2,2-dimethylbutyl)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
| SMILES | CC(C)(CCC#N)CNC([C@H](O)[C@H](Cc1ccccc1)NC(=O)O[C@@H]1CO[C@@H]2OCC[C@@H]21)S(=O)(=O)c1cccc(N)c1 |
| InChI | InChI=1S/C30H40N4O7S/c1-30(2,13-7-14-31)19-33-27(42(37,38)22-11-6-10-21(32)17-22)26(35)24(16-20-8-4-3-5-9-20)34-29(36)41-25-18-40-28-23(25)12-15-39-28/h3-6,8-11,17,23-28,33,35H,7,12-13,15-16,18-19,32H2,1-2H3,(H,34,36)/t23-,24+,25-,26-,27?,28+/m1/s1 |
| InChIKey | KPVMQYZOBXMCJH-BYAKZSFSSA-N |
| XLogP | 2.75 |
| TPSA | 173.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.74 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|