C31H42N4O7 — CID 91368794
[(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3R)-4-[(4-cyano-2,2-dimethylbutyl)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate;1-methyl-4-nitrobenzene (PubChem CID 91368794) has the molecular formula C31H42N4O7 and a molecular weight of 582.70 g/mol. Its IUPAC name is [(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3R)-4-[(4-cyano-2,2-dimethylbutyl)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate;1-methyl-4-nitrobenzene.
| Compound Name | [(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3R)-4-[(4-cyano-2,2-dimethylbutyl)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate;1-methyl-4-nitrobenzene |
|---|---|
| PubChem CID | 91368794 |
| Molecular Formula | C31H42N4O7 |
| Molecular Weight | 582.70 g/mol |
| Exact Mass | 582.31 |
| IUPAC Name | [(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3R)-4-[(4-cyano-2,2-dimethylbutyl)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate;1-methyl-4-nitrobenzene |
| SMILES | CC(C)(CCC#N)CNC[C@@H](O)[C@H](Cc1ccccc1)NC(=O)O[C@H]1CO[C@H]2OCC[C@H]21.Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H35N3O5.C7H7NO2/c1-24(2,10-6-11-25)16-26-14-20(28)19(13-17-7-4-3-5-8-17)27-23(29)32-21-15-31-22-18(21)9-12-30-22;1-6-2-4-7(5-3-6)8(9)10/h3-5,7-8,18-22,26,28H,6,9-10,12-16H2,1-2H3,(H,27,29);2-5H,1H3/t18-,19-,20+,21-,22+;/m0./s1 |
| InChIKey | QACKJEUNKRMCDW-KDWCKCMCSA-N |
| XLogP | 4.27 |
| TPSA | 155.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.70 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|