C22H31NO5S — CID 142012610
methyl 6-[1-(3-methylsulfanylpropyl)cyclobutyl]-2-[(4-nitrophenyl)methyl]-6-oxohexanoate (PubChem CID 142012610) has the molecular formula C22H31NO5S and a molecular weight of 421.56 g/mol. Its IUPAC name is methyl 6-[1-(3-methylsulfanylpropyl)cyclobutyl]-2-[(4-nitrophenyl)methyl]-6-oxohexanoate.
| Compound Name | methyl 6-[1-(3-methylsulfanylpropyl)cyclobutyl]-2-[(4-nitrophenyl)methyl]-6-oxohexanoate |
|---|---|
| PubChem CID | 142012610 |
| Molecular Formula | C22H31NO5S |
| Molecular Weight | 421.56 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | methyl 6-[1-(3-methylsulfanylpropyl)cyclobutyl]-2-[(4-nitrophenyl)methyl]-6-oxohexanoate |
| SMILES | COC(=O)C(CCCC(=O)C1(CCCSC)CCC1)Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H31NO5S/c1-28-21(25)18(16-17-8-10-19(11-9-17)23(26)27)6-3-7-20(24)22(12-4-13-22)14-5-15-29-2/h8-11,18H,3-7,12-16H2,1-2H3 |
| InChIKey | GZZNYEXYHDEKAK-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.56 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|