C31H22N2PtS2 — CID 142014507
4-methylbenzene-1,2-dithiolate;platinum(2+);3-(6-quinolin-3-ylhexa-1,5-diynyl)quinoline (PubChem CID 142014507) has the molecular formula C31H22N2PtS2 and a molecular weight of 681.74 g/mol. Its IUPAC name is 4-methylbenzene-1,2-dithiolate;platinum(2+);3-(6-quinolin-3-ylhexa-1,5-diynyl)quinoline.
| Compound Name | 4-methylbenzene-1,2-dithiolate;platinum(2+);3-(6-quinolin-3-ylhexa-1,5-diynyl)quinoline |
|---|---|
| PubChem CID | 142014507 |
| Molecular Formula | C31H22N2PtS2 |
| Molecular Weight | 681.74 g/mol |
| Exact Mass | 681.09 |
| IUPAC Name | 4-methylbenzene-1,2-dithiolate;platinum(2+);3-(6-quinolin-3-ylhexa-1,5-diynyl)quinoline |
| SMILES | C(#Cc1cnc2ccccc2c1)CCC#Cc1cnc2ccccc2c1.Cc1ccc([S-])c([S-])c1.[Pt+2] |
| InChI | InChI=1S/C24H16N2.C7H8S2.Pt/c1(3-9-19-15-21-11-5-7-13-23(21)25-17-19)2-4-10-20-16-22-12-6-8-14-24(22)26-18-20;1-5-2-3-6(8)7(9)4-5;/h5-8,11-18H,1-2H2;2-4,8-9H,1H3;/q;;+2/p-2 |
| InChIKey | WKUXDLWCRNRSHU-UHFFFAOYSA-L |
| XLogP | 6.77 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.74 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|