About 6,7-dimethoxy-3-propan-2-yl-1,2-benzoxazole
6,7-dimethoxy-3-propan-2-yl-1,2-benzoxazole (PubChem CID 142014724) has the molecular formula C12H15NO3
and a molecular weight of 221.26 g/mol. Its IUPAC name is 6,7-dimethoxy-3-propan-2-yl-1,2-benzoxazole.
Molecular Properties
| Compound Name | 6,7-dimethoxy-3-propan-2-yl-1,2-benzoxazole |
| PubChem CID | 142014724 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | 6,7-dimethoxy-3-propan-2-yl-1,2-benzoxazole |
| SMILES | COc1ccc2c(C(C)C)noc2c1OC |
| InChI | InChI=1S/C12H15NO3/c1-7(2)10-8-5-6-9(14-3)12(15-4)11(8)16-13-10/h5-7H,1-4H3 |
| InChIKey | KEBPJEBHQLTWIH-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 44.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6,7-dimethoxy-3-propan-2-yl-1,2-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dimethoxy-3-propan-2-yl-1,2-benzoxazole?
The IUPAC name of 6,7-dimethoxy-3-propan-2-yl-1,2-benzoxazole (CID 142014724) is 6,7-dimethoxy-3-propan-2-yl-1,2-benzoxazole.
What is the SMILES notation for 6,7-dimethoxy-3-propan-2-yl-1,2-benzoxazole?
The canonical SMILES for 6,7-dimethoxy-3-propan-2-yl-1,2-benzoxazole is COc1ccc2c(C(C)C)noc2c1OC.
What is the InChIKey of 6,7-dimethoxy-3-propan-2-yl-1,2-benzoxazole?
The InChIKey is KEBPJEBHQLTWIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO3/c1-7(2)10-8-5-6-9(14-3)12(15-4)11(8)16-13-10/h5-7H,1-4H3.
What are the key properties of 6,7-dimethoxy-3-propan-2-yl-1,2-benzoxazole?
6,7-dimethoxy-3-propan-2-yl-1,2-benzoxazole has a molecular weight of 221.26 g/mol, XLogP of 2.97, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dimethoxy-3-propan-2-yl-1,2-benzoxazole is sourced from PubChem (CID 142014724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).