C32H55ClN6O8 — CID 142016744
2-N-[2-[bis(2,2-dimethyl-1,3-dioxan-5-yl)amino]ethyl]-4-N-[3,3-bis(2,2-dimethyl-1,3-dioxan-5-yl)propyl]-6-chloro-1,3,5-triazine-2,4-diamine (PubChem CID 142016744) has the molecular formula C32H55ClN6O8 and a molecular weight of 687.28 g/mol. Its IUPAC name is 2-N-[2-[bis(2,2-dimethyl-1,3-dioxan-5-yl)amino]ethyl]-4-N-[3,3-bis(2,2-dimethyl-1,3-dioxan-5-yl)propyl]-6-chloro-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-[2-[bis(2,2-dimethyl-1,3-dioxan-5-yl)amino]ethyl]-4-N-[3,3-bis(2,2-dimethyl-1,3-dioxan-5-yl)propyl]-6-chloro-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 142016744 |
| Molecular Formula | C32H55ClN6O8 |
| Molecular Weight | 687.28 g/mol |
| Exact Mass | 686.38 |
| IUPAC Name | 2-N-[2-[bis(2,2-dimethyl-1,3-dioxan-5-yl)amino]ethyl]-4-N-[3,3-bis(2,2-dimethyl-1,3-dioxan-5-yl)propyl]-6-chloro-1,3,5-triazine-2,4-diamine |
| SMILES | CC1(C)OCC(C(CCNc2nc(Cl)nc(NCCN(C3COC(C)(C)OC3)C3COC(C)(C)OC3)n2)C2COC(C)(C)OC2)CO1 |
| InChI | InChI=1S/C32H55ClN6O8/c1-29(2)40-13-21(14-41-29)25(22-15-42-30(3,4)43-16-22)9-10-34-27-36-26(33)37-28(38-27)35-11-12-39(23-17-44-31(5,6)45-18-23)24-19-46-32(7,8)47-20-24/h21-25H,9-20H2,1-8H3,(H2,34,35,36,37,38) |
| InChIKey | WDSOLCMPEYDZFY-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 139.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.28 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |