C27H50N6O4 — CID 22382381
2-N,2-N-bis(2,2-dimethyl-1,3-dioxan-5-yl)-4-N,6-N-dihexyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 22382381) has the molecular formula C27H50N6O4 and a molecular weight of 522.74 g/mol. Its IUPAC name is 2-N,2-N-bis(2,2-dimethyl-1,3-dioxan-5-yl)-4-N,6-N-dihexyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,2-N-bis(2,2-dimethyl-1,3-dioxan-5-yl)-4-N,6-N-dihexyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 22382381 |
| Molecular Formula | C27H50N6O4 |
| Molecular Weight | 522.74 g/mol |
| Exact Mass | 522.39 |
| IUPAC Name | 2-N,2-N-bis(2,2-dimethyl-1,3-dioxan-5-yl)-4-N,6-N-dihexyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCCCCCNc1nc(NCCCCCC)nc(N(C2COC(C)(C)OC2)C2COC(C)(C)OC2)n1 |
| InChI | InChI=1S/C27H50N6O4/c1-7-9-11-13-15-28-23-30-24(29-16-14-12-10-8-2)32-25(31-23)33(21-17-34-26(3,4)35-18-21)22-19-36-27(5,6)37-20-22/h21-22H,7-20H2,1-6H3,(H2,28,29,30,31,32) |
| InChIKey | PPBZZWGIAIABCX-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 102.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.74 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|