C19H20N2O5S — CID 142019525
3-[4-[(6-methoxy-1H-benzimidazol-2-yl)methoxy]phenyl]-2-methylsulfinylpropanoic acid (PubChem CID 142019525) has the molecular formula C19H20N2O5S and a molecular weight of 388.45 g/mol. Its IUPAC name is 3-[4-[(6-methoxy-1H-benzimidazol-2-yl)methoxy]phenyl]-2-methylsulfinylpropanoic acid.
| Compound Name | 3-[4-[(6-methoxy-1H-benzimidazol-2-yl)methoxy]phenyl]-2-methylsulfinylpropanoic acid |
|---|---|
| PubChem CID | 142019525 |
| Molecular Formula | C19H20N2O5S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | 3-[4-[(6-methoxy-1H-benzimidazol-2-yl)methoxy]phenyl]-2-methylsulfinylpropanoic acid |
| SMILES | COc1ccc2nc(COc3ccc(CC(C(=O)O)S(C)=O)cc3)[nH]c2c1 |
| InChI | InChI=1S/C19H20N2O5S/c1-25-14-7-8-15-16(10-14)21-18(20-15)11-26-13-5-3-12(4-6-13)9-17(19(22)23)27(2)24/h3-8,10,17H,9,11H2,1-2H3,(H,20,21)(H,22,23) |
| InChIKey | YACKMZJKQFTLCD-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 101.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |