C17H26BrNO — CID 142020380
N-[4-(bromomethyl)phenyl]-N-[(1Z)-buta-1,3-dienyl]acetamide;ethane (PubChem CID 142020380) has the molecular formula C17H26BrNO and a molecular weight of 340.31 g/mol. Its IUPAC name is N-[4-(bromomethyl)phenyl]-N-[(1Z)-buta-1,3-dienyl]acetamide;ethane.
| Compound Name | N-[4-(bromomethyl)phenyl]-N-[(1Z)-buta-1,3-dienyl]acetamide;ethane |
|---|---|
| PubChem CID | 142020380 |
| Molecular Formula | C17H26BrNO |
| Molecular Weight | 340.31 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | N-[4-(bromomethyl)phenyl]-N-[(1Z)-buta-1,3-dienyl]acetamide;ethane |
| SMILES | C=C/C=C\N(C(C)=O)c1ccc(CBr)cc1.CC.CC |
| InChI | InChI=1S/C13H14BrNO.2C2H6/c1-3-4-9-15(11(2)16)13-7-5-12(10-14)6-8-13;2*1-2/h3-9H,1,10H2,2H3;2*1-2H3/b9-4-;; |
| InChIKey | QKLFKBQMTYYMFI-FPAIPBCFSA-N |
| XLogP | 5.69 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.31 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|