C17H18Br2N2O — CID 23199604
1,3-bis[4-(bromomethyl)phenyl]-1,3-dimethylurea (PubChem CID 23199604) has the molecular formula C17H18Br2N2O and a molecular weight of 426.15 g/mol. Its IUPAC name is 1,3-bis[4-(bromomethyl)phenyl]-1,3-dimethylurea.
| Compound Name | 1,3-bis[4-(bromomethyl)phenyl]-1,3-dimethylurea |
|---|---|
| PubChem CID | 23199604 |
| Molecular Formula | C17H18Br2N2O |
| Molecular Weight | 426.15 g/mol |
| Exact Mass | 423.98 |
| IUPAC Name | 1,3-bis[4-(bromomethyl)phenyl]-1,3-dimethylurea |
| SMILES | CN(C(=O)N(C)c1ccc(CBr)cc1)c1ccc(CBr)cc1 |
| InChI | InChI=1S/C17H18Br2N2O/c1-20(15-7-3-13(11-18)4-8-15)17(22)21(2)16-9-5-14(12-19)6-10-16/h3-10H,11-12H2,1-2H3 |
| InChIKey | VPFOARZVEKLLRM-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.15 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|