C15H14I2N2O — CID 101347516
1,3-bis(4-iodophenyl)-1,3-dimethylurea (PubChem CID 101347516) has the molecular formula C15H14I2N2O and a molecular weight of 492.10 g/mol. Its IUPAC name is 1,3-bis(4-iodophenyl)-1,3-dimethylurea.
| Compound Name | 1,3-bis(4-iodophenyl)-1,3-dimethylurea |
|---|---|
| PubChem CID | 101347516 |
| Molecular Formula | C15H14I2N2O |
| Molecular Weight | 492.10 g/mol |
| Exact Mass | 491.92 |
| IUPAC Name | 1,3-bis(4-iodophenyl)-1,3-dimethylurea |
| SMILES | CN(C(=O)N(C)c1ccc(I)cc1)c1ccc(I)cc1 |
| InChI | InChI=1S/C15H14I2N2O/c1-18(13-7-3-11(16)4-8-13)15(20)19(2)14-9-5-12(17)6-10-14/h3-10H,1-2H3 |
| InChIKey | MPOYGJHODDVOHW-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.10 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|