About Se-(4-iodophenyl) ethaneselenoate
Se-(4-iodophenyl) ethaneselenoate (PubChem CID 10782266) has the molecular formula C8H7IOSe
and a molecular weight of 325.01 g/mol. Its IUPAC name is Se-(4-iodophenyl) ethaneselenoate.
Molecular Properties
| Compound Name | Se-(4-iodophenyl) ethaneselenoate |
| PubChem CID | 10782266 |
| Molecular Formula | C8H7IOSe |
| Molecular Weight | 325.01 g/mol |
| Exact Mass | 325.87 |
| IUPAC Name | Se-(4-iodophenyl) ethaneselenoate |
| SMILES | CC(=O)[Se]c1ccc(I)cc1 |
| InChI | InChI=1S/C8H7IOSe/c1-6(10)11-8-4-2-7(9)3-5-8/h2-5H,1H3 |
| InChIKey | FPHGGTUBQKQTDI-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.01 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze Se-(4-iodophenyl) ethaneselenoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Se-(4-iodophenyl) ethaneselenoate?
The IUPAC name of Se-(4-iodophenyl) ethaneselenoate (CID 10782266) is Se-(4-iodophenyl) ethaneselenoate.
What is the SMILES notation for Se-(4-iodophenyl) ethaneselenoate?
The canonical SMILES for Se-(4-iodophenyl) ethaneselenoate is CC(=O)[Se]c1ccc(I)cc1.
What is the InChIKey of Se-(4-iodophenyl) ethaneselenoate?
The InChIKey is FPHGGTUBQKQTDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7IOSe/c1-6(10)11-8-4-2-7(9)3-5-8/h2-5H,1H3.
What are the key properties of Se-(4-iodophenyl) ethaneselenoate?
Se-(4-iodophenyl) ethaneselenoate has a molecular weight of 325.01 g/mol, XLogP of 1.17, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for Se-(4-iodophenyl) ethaneselenoate is sourced from PubChem (CID 10782266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).