C23H28FNO2 — CID 142020894
benzyl 2-[3-(3-fluorophenyl)pyrrolidin-1-yl]-3,3-dimethylbutanoate (PubChem CID 142020894) has the molecular formula C23H28FNO2 and a molecular weight of 369.48 g/mol. Its IUPAC name is benzyl 2-[3-(3-fluorophenyl)pyrrolidin-1-yl]-3,3-dimethylbutanoate.
| Compound Name | benzyl 2-[3-(3-fluorophenyl)pyrrolidin-1-yl]-3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 142020894 |
| Molecular Formula | C23H28FNO2 |
| Molecular Weight | 369.48 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | benzyl 2-[3-(3-fluorophenyl)pyrrolidin-1-yl]-3,3-dimethylbutanoate |
| SMILES | CC(C)(C)C(C(=O)OCc1ccccc1)N1CCC(c2cccc(F)c2)C1 |
| InChI | InChI=1S/C23H28FNO2/c1-23(2,3)21(22(26)27-16-17-8-5-4-6-9-17)25-13-12-19(15-25)18-10-7-11-20(24)14-18/h4-11,14,19,21H,12-13,15-16H2,1-3H3 |
| InChIKey | PQDHBQZQUNOVRJ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.48 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |