C26H30FNO3 — CID 86757208
benzyl (2R)-3-cyclopentyl-2-[(3S,4R)-3-(3-fluorophenyl)-4-formylpyrrolidin-1-yl]propanoate (PubChem CID 86757208) has the molecular formula C26H30FNO3 and a molecular weight of 423.53 g/mol. Its IUPAC name is benzyl (2R)-3-cyclopentyl-2-[(3S,4R)-3-(3-fluorophenyl)-4-formylpyrrolidin-1-yl]propanoate.
| Compound Name | benzyl (2R)-3-cyclopentyl-2-[(3S,4R)-3-(3-fluorophenyl)-4-formylpyrrolidin-1-yl]propanoate |
|---|---|
| PubChem CID | 86757208 |
| Molecular Formula | C26H30FNO3 |
| Molecular Weight | 423.53 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | benzyl (2R)-3-cyclopentyl-2-[(3S,4R)-3-(3-fluorophenyl)-4-formylpyrrolidin-1-yl]propanoate |
| SMILES | O=C[C@H]1CN([C@H](CC2CCCC2)C(=O)OCc2ccccc2)C[C@@H]1c1cccc(F)c1 |
| InChI | InChI=1S/C26H30FNO3/c27-23-12-6-11-21(14-23)24-16-28(15-22(24)17-29)25(13-19-7-4-5-8-19)26(30)31-18-20-9-2-1-3-10-20/h1-3,6,9-12,14,17,19,22,24-25H,4-5,7-8,13,15-16,18H2/t22-,24-,25-/m1/s1 |
| InChIKey | OIGHNGNNCKFQIT-QLBJFCOMSA-N |
| XLogP | 4.73 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.53 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|