C19H24FNO3 — CID 20664076
(2R,3R)-3-cyclobutyl-2-[(3S,4R)-3-(3-fluorophenyl)-4-formylpyrrolidin-1-yl]butanoic acid (PubChem CID 20664076) has the molecular formula C19H24FNO3 and a molecular weight of 333.40 g/mol. Its IUPAC name is (2R,3R)-3-cyclobutyl-2-[(3S,4R)-3-(3-fluorophenyl)-4-formylpyrrolidin-1-yl]butanoic acid.
| Compound Name | (2R,3R)-3-cyclobutyl-2-[(3S,4R)-3-(3-fluorophenyl)-4-formylpyrrolidin-1-yl]butanoic acid |
|---|---|
| PubChem CID | 20664076 |
| Molecular Formula | C19H24FNO3 |
| Molecular Weight | 333.40 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | (2R,3R)-3-cyclobutyl-2-[(3S,4R)-3-(3-fluorophenyl)-4-formylpyrrolidin-1-yl]butanoic acid |
| SMILES | C[C@H](C1CCC1)[C@H](C(=O)O)N1C[C@H](c2cccc(F)c2)[C@@H](C=O)C1 |
| InChI | InChI=1S/C19H24FNO3/c1-12(13-4-2-5-13)18(19(23)24)21-9-15(11-22)17(10-21)14-6-3-7-16(20)8-14/h3,6-8,11-13,15,17-18H,2,4-5,9-10H2,1H3,(H,23,24)/t12-,15-,17-,18-/m1/s1 |
| InChIKey | FXYBVGLIQSKCIL-DGCUDZEOSA-N |
| XLogP | 2.93 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.40 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|