C25H28FNO3 — CID 18342673
benzyl 3-cyclobutyl-2-[3-(3-fluorophenyl)-4-formylpyrrolidin-1-yl]propanoate (PubChem CID 18342673) has the molecular formula C25H28FNO3 and a molecular weight of 409.50 g/mol. Its IUPAC name is benzyl 3-cyclobutyl-2-[3-(3-fluorophenyl)-4-formylpyrrolidin-1-yl]propanoate.
| Compound Name | benzyl 3-cyclobutyl-2-[3-(3-fluorophenyl)-4-formylpyrrolidin-1-yl]propanoate |
|---|---|
| PubChem CID | 18342673 |
| Molecular Formula | C25H28FNO3 |
| Molecular Weight | 409.50 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | benzyl 3-cyclobutyl-2-[3-(3-fluorophenyl)-4-formylpyrrolidin-1-yl]propanoate |
| SMILES | O=CC1CN(C(CC2CCC2)C(=O)OCc2ccccc2)CC1c1cccc(F)c1 |
| InChI | InChI=1S/C25H28FNO3/c26-22-11-5-10-20(13-22)23-15-27(14-21(23)16-28)24(12-18-8-4-9-18)25(29)30-17-19-6-2-1-3-7-19/h1-3,5-7,10-11,13,16,18,21,23-24H,4,8-9,12,14-15,17H2 |
| InChIKey | XRYFHDSQLRUXHE-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.50 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|