C36H54N2O — CID 142021016
3-cyclohexyl-3-(3-phenylpyrrolidin-1-yl)prop-1-en-2-ol;4-(2,2-dimethyl-3-phenylpropyl)-1-methylpiperidine (PubChem CID 142021016) has the molecular formula C36H54N2O and a molecular weight of 530.84 g/mol. Its IUPAC name is 3-cyclohexyl-3-(3-phenylpyrrolidin-1-yl)prop-1-en-2-ol;4-(2,2-dimethyl-3-phenylpropyl)-1-methylpiperidine.
| Compound Name | 3-cyclohexyl-3-(3-phenylpyrrolidin-1-yl)prop-1-en-2-ol;4-(2,2-dimethyl-3-phenylpropyl)-1-methylpiperidine |
|---|---|
| PubChem CID | 142021016 |
| Molecular Formula | C36H54N2O |
| Molecular Weight | 530.84 g/mol |
| Exact Mass | 530.42 |
| IUPAC Name | 3-cyclohexyl-3-(3-phenylpyrrolidin-1-yl)prop-1-en-2-ol;4-(2,2-dimethyl-3-phenylpropyl)-1-methylpiperidine |
| SMILES | C=C(O)C(C1CCCCC1)N1CCC(c2ccccc2)C1.CN1CCC(CC(C)(C)Cc2ccccc2)CC1 |
| InChI | InChI=1S/C19H27NO.C17H27N/c1-15(21)19(17-10-6-3-7-11-17)20-13-12-18(14-20)16-8-4-2-5-9-16;1-17(2,13-15-7-5-4-6-8-15)14-16-9-11-18(3)12-10-16/h2,4-5,8-9,17-19,21H,1,3,6-7,10-14H2;4-8,16H,9-14H2,1-3H3 |
| InChIKey | QJXRZZRQQJMALU-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.84 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|